C28H37N3O3 — CID 155789826
(1S,2R,10S,11R,15R,16R,17S,20S,21S)-2,13,13,21-tetramethyl-20-pyridin-2-yl-12,14-dioxa-6,7-diazahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),5-dien-20-ol (PubChem CID 155789826) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is (1S,2R,10S,11R,15R,16R,17S,20S,21S)-2,13,13,21-tetramethyl-20-pyridin-2-yl-12,14-dioxa-6,7-diazahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),5-dien-20-ol.
| Compound Name | (1S,2R,10S,11R,15R,16R,17S,20S,21S)-2,13,13,21-tetramethyl-20-pyridin-2-yl-12,14-dioxa-6,7-diazahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),5-dien-20-ol |
|---|---|
| PubChem CID | 155789826 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (1S,2R,10S,11R,15R,16R,17S,20S,21S)-2,13,13,21-tetramethyl-20-pyridin-2-yl-12,14-dioxa-6,7-diazahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),5-dien-20-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@H]1Cc3[nH]ncc3C[C@]1(C)[C@H]1CC[C@@]3(C)[C@@H](CC[C@@]3(O)c3ccccn3)[C@H]21 |
| InChI | InChI=1S/C28H37N3O3/c1-25(2)33-23-19-13-20-16(15-30-31-20)14-26(19,3)17-8-10-27(4)18(22(17)24(23)34-25)9-11-28(27,32)21-7-5-6-12-29-21/h5-7,12,15,17-19,22-24,32H,8-11,13-14H2,1-4H3,(H,30,31)/t17-,18-,19+,22+,23+,24+,26+,27-,28+/m0/s1 |
| InChIKey | BDZAHMZZADQOJZ-YDJMWUALSA-N |
| XLogP | 4.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |