About 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol
3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol (PubChem CID 15578993) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol |
| PubChem CID | 15578993 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol |
| SMILES | OCCCc1cnc2ncnn2c1 |
| InChI | InChI=1S/C8H10N4O/c13-3-1-2-7-4-9-8-10-6-11-12(8)5-7/h4-6,13H,1-3H2 |
| InChIKey | IQKLNRWUTAAYQD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
The IUPAC name of 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol (CID 15578993) is 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol.
What is the SMILES notation for 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
The canonical SMILES for 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol is OCCCc1cnc2ncnn2c1.
What is the InChIKey of 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
The InChIKey is IQKLNRWUTAAYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c13-3-1-2-7-4-9-8-10-6-11-12(8)5-7/h4-6,13H,1-3H2.
What are the key properties of 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol has a molecular weight of 178.19 g/mol, XLogP of 0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol is sourced from PubChem (CID 15578993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).