About 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine
6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine (PubChem CID 155790085) has the molecular formula C12H16F2N4
and a molecular weight of 254.28 g/mol. Its IUPAC name is 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 155790085 |
| Molecular Formula | C12H16F2N4 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine |
| SMILES | CCC(F)(F)n1ncc2cnc(C(C)(C)C)nc21 |
| InChI | InChI=1S/C12H16F2N4/c1-5-12(13,14)18-9-8(7-16-18)6-15-10(17-9)11(2,3)4/h6-7H,5H2,1-4H3 |
| InChIKey | CVOSJJGPNCGQCD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine (CID 155790085) is 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine is CCC(F)(F)n1ncc2cnc(C(C)(C)C)nc21.
What is the InChIKey of 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine?
The InChIKey is CVOSJJGPNCGQCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N4/c1-5-12(13,14)18-9-8(7-16-18)6-15-10(17-9)11(2,3)4/h6-7H,5H2,1-4H3.
What are the key properties of 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine?
6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine has a molecular weight of 254.28 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-1-(1,1-difluoropropyl)pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 155790085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).