C15H18N4O3 — CID 155790117
N-[6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]acetamide (PubChem CID 155790117) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]acetamide.
| Compound Name | N-[6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 155790117 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[6-(6,8-dioxo-2,7-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2CCC3(CCC(=O)NC3=O)C2)nc1 |
| InChI | InChI=1S/C15H18N4O3/c1-10(20)17-11-2-3-12(16-8-11)19-7-6-15(9-19)5-4-13(21)18-14(15)22/h2-3,8H,4-7,9H2,1H3,(H,17,20)(H,18,21,22) |
| InChIKey | JTPHDUQRXRKFJN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|