C14H6N2O4 — CID 15579019
6-nitro-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 15579019) has the molecular formula C14H6N2O4 and a molecular weight of 266.21 g/mol. Its IUPAC name is 6-nitro-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 6-nitro-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 15579019 |
| Molecular Formula | C14H6N2O4 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 6-nitro-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | O=C1c2c(cccc2[N+](=O)[O-])-c2onc3cccc1c23 |
| InChI | InChI=1S/C14H6N2O4/c17-13-7-3-1-5-9-11(7)14(20-15-9)8-4-2-6-10(12(8)13)16(18)19/h1-6H |
| InChIKey | TWUFIYMSRFOLPF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|