C34H31N3O8P2 — CID 155790269
1-(2-methoxyethyl)-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 155790269) has the molecular formula C34H31N3O8P2 and a molecular weight of 671.58 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2-methoxyethyl)-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 155790269 |
| Molecular Formula | C34H31N3O8P2 |
| Molecular Weight | 671.58 g/mol |
| Exact Mass | 671.16 |
| IUPAC Name | 1-(2-methoxyethyl)-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | COCCn1c(=O)n(CCP2(=O)Oc3ccccc3-c3ccccc32)c(=O)n(CCP2(=O)Oc3ccccc3-c3ccccc32)c1=O |
| InChI | InChI=1S/C34H31N3O8P2/c1-43-21-18-35-32(38)36(19-22-46(41)30-16-8-4-12-26(30)24-10-2-6-14-28(24)44-46)34(40)37(33(35)39)20-23-47(42)31-17-9-5-13-27(31)25-11-3-7-15-29(25)45-47/h2-17H,18-23H2,1H3 |
| InChIKey | XEEVPLCPNCVFJF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|