C14H16N2 — CID 155791370
2,3,3-trimethyl-5a,9a-dihydropyrrolo[3,2-h]quinoline (PubChem CID 155791370) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 2,3,3-trimethyl-5a,9a-dihydropyrrolo[3,2-h]quinoline.
| Compound Name | 2,3,3-trimethyl-5a,9a-dihydropyrrolo[3,2-h]quinoline |
|---|---|
| PubChem CID | 155791370 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2,3,3-trimethyl-5a,9a-dihydropyrrolo[3,2-h]quinoline |
| SMILES | CC1=NC2=C(C=CC3C=CC=NC23)C1(C)C |
| InChI | InChI=1S/C14H16N2/c1-9-14(2,3)11-7-6-10-5-4-8-15-12(10)13(11)16-9/h4-8,10,12H,1-3H3 |
| InChIKey | ZOJAQAWGKHJLGZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |