C16H20IrN2-2 — CID 155791447
iridium;4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide (PubChem CID 155791447) has the molecular formula C16H20IrN2-2 and a molecular weight of 435.59 g/mol. Its IUPAC name is iridium;4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide.
| Compound Name | iridium;4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide |
|---|---|
| PubChem CID | 155791447 |
| Molecular Formula | C16H20IrN2-2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | iridium;4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide |
| SMILES | [2H]C([2H])([2H])N1C=C2N([CH-]1)c1[c-]cccc1C(C)(C)C2(C)C.[Ir] |
| InChI | InChI=1S/C16H20N2.Ir/c1-15(2)12-8-6-7-9-13(12)18-11-17(5)10-14(18)16(15,3)4;/h6-8,10-11H,1-5H3;/q-2;/i5D3; |
| InChIKey | VARAJLFEOUFUEX-OWKBQAHQSA-N |
| XLogP | 3.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|