C29H33BN3+ — CID 155791450
5-[2,6-di(propan-2-yl)phenyl]-1,10-dimethyl-6-phenylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium (PubChem CID 155791450) has the molecular formula C29H33BN3+ and a molecular weight of 434.42 g/mol. Its IUPAC name is 5-[2,6-di(propan-2-yl)phenyl]-1,10-dimethyl-6-phenylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium.
| Compound Name | 5-[2,6-di(propan-2-yl)phenyl]-1,10-dimethyl-6-phenylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium |
|---|---|
| PubChem CID | 155791450 |
| Molecular Formula | C29H33BN3+ |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 5-[2,6-di(propan-2-yl)phenyl]-1,10-dimethyl-6-phenylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium |
| SMILES | Cc1cccc2c1-c1n(C)cc[n+]1B(c1c(C(C)C)cccc1C(C)C)N2c1ccccc1 |
| InChI | InChI=1S/C29H33BN3/c1-20(2)24-15-11-16-25(21(3)4)28(24)30-32-19-18-31(6)29(32)27-22(5)12-10-17-26(27)33(30)23-13-8-7-9-14-23/h7-21H,1-6H3/q+1 |
| InChIKey | DJAGAFLYYHTEFK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|