About 2-(benzenesulfonyl)-N,N-diethylethanamine
2-(benzenesulfonyl)-N,N-diethylethanamine (PubChem CID 15579151) has the molecular formula C12H19NO2S
and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-N,N-diethylethanamine |
| PubChem CID | 15579151 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-(benzenesulfonyl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO2S/c1-3-13(4-2)10-11-16(14,15)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | VKVGRHXNGOKAQM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-N,N-diethylethanamine?
The IUPAC name of 2-(benzenesulfonyl)-N,N-diethylethanamine (CID 15579151) is 2-(benzenesulfonyl)-N,N-diethylethanamine.
What is the SMILES notation for 2-(benzenesulfonyl)-N,N-diethylethanamine?
The canonical SMILES for 2-(benzenesulfonyl)-N,N-diethylethanamine is CCN(CC)CCS(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)-N,N-diethylethanamine?
The InChIKey is VKVGRHXNGOKAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2S/c1-3-13(4-2)10-11-16(14,15)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3.
What are the key properties of 2-(benzenesulfonyl)-N,N-diethylethanamine?
2-(benzenesulfonyl)-N,N-diethylethanamine has a molecular weight of 241.36 g/mol, XLogP of 1.80, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-N,N-diethylethanamine is sourced from PubChem (CID 15579151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).