C26H34F2N4O2 — CID 155791952
N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide (PubChem CID 155791952) has the molecular formula C26H34F2N4O2 and a molecular weight of 472.58 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155791952 |
| Molecular Formula | C26H34F2N4O2 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)NC1CCC(CCN2CCc3ccc(OCC(F)F)nc3CC2)CC1 |
| InChI | InChI=1S/C26H34F2N4O2/c1-18-22(3-2-13-29-18)26(33)30-21-7-4-19(5-8-21)10-14-32-15-11-20-6-9-25(34-17-24(27)28)31-23(20)12-16-32/h2-3,6,9,13,19,21,24H,4-5,7-8,10-12,14-17H2,1H3,(H,30,33) |
| InChIKey | UFMVMASXCZSNCW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |