C24H29ClN8O — CID 155792056
2-[6-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-3,4-dihydro-2H-quinolin-1-yl]-N-propan-2-ylacetamide (PubChem CID 155792056) has the molecular formula C24H29ClN8O and a molecular weight of 481.00 g/mol. Its IUPAC name is 2-[6-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-3,4-dihydro-2H-quinolin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[6-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-3,4-dihydro-2H-quinolin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 155792056 |
| Molecular Formula | C24H29ClN8O |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[6-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1-methyl-1,2,4-triazol-3-yl]-3,4-dihydro-2H-quinolin-1-yl]-N-propan-2-ylacetamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nc(-c3ccc4c(c3)CCCN4CC(=O)NC(C)C)nn2C)c1Cl |
| InChI | InChI=1S/C24H29ClN8O/c1-14(2)28-21(34)13-33-10-4-5-15-11-16(6-9-20(15)33)23-30-24(32(3)31-23)29-19-8-7-18(27)17(12-26)22(19)25/h6-9,11-12,14,26H,4-5,10,13,27H2,1-3H3,(H,28,34)(H,29,30,31)/b26-12+ |
| InChIKey | VRDYOMVUSAMZOW-RPPGKUMJSA-N |
| XLogP | 3.74 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|