C10H19N3O — CID 155792167
2-[3,5-di(propan-2-yl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 155792167) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[3,5-di(propan-2-yl)-1,2,4-triazol-1-yl]ethanol.
| Compound Name | 2-[3,5-di(propan-2-yl)-1,2,4-triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 155792167 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-[3,5-di(propan-2-yl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | CC(C)c1nc(C(C)C)n(CCO)n1 |
| InChI | InChI=1S/C10H19N3O/c1-7(2)9-11-10(8(3)4)13(12-9)5-6-14/h7-8,14H,5-6H2,1-4H3 |
| InChIKey | MDOZOWSPWKTEJZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |