C20H16F2N4O2 — CID 155792264
tert-butyl 11-(2,3-difluoro-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate (PubChem CID 155792264) has the molecular formula C20H16F2N4O2 and a molecular weight of 382.37 g/mol. Its IUPAC name is tert-butyl 11-(2,3-difluoro-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate.
| Compound Name | tert-butyl 11-(2,3-difluoro-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 155792264 |
| Molecular Formula | C20H16F2N4O2 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | tert-butyl 11-(2,3-difluoro-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccncc2c2ccc(-c3ccnc(F)c3F)nc21 |
| InChI | InChI=1S/C20H16F2N4O2/c1-20(2,3)28-19(27)26-15-7-8-23-10-13(15)11-4-5-14(25-18(11)26)12-6-9-24-17(22)16(12)21/h4-10H,1-3H3 |
| InChIKey | SIPXRAQIVQMKFJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|