C34H22FN5O2 — CID 155792272
11-(6-fluoro-2-nitro-3-pyridinyl)-8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 155792272) has the molecular formula C34H22FN5O2 and a molecular weight of 551.58 g/mol. Its IUPAC name is 11-(6-fluoro-2-nitro-3-pyridinyl)-8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-(6-fluoro-2-nitro-3-pyridinyl)-8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 155792272 |
| Molecular Formula | C34H22FN5O2 |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 11-(6-fluoro-2-nitro-3-pyridinyl)-8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | O=[N+]([O-])c1nc(F)ccc1-c1ccc2c3cnccc3n(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2n1 |
| InChI | InChI=1S/C34H22FN5O2/c35-31-19-17-27(33(38-31)40(41)42)29-18-16-26-28-22-36-21-20-30(28)39(32(26)37-29)34(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-22H |
| InChIKey | HOKVVSQFUOJBSP-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|