C17H9FN4 — CID 155792277
11-(3-fluoro-4-isocyanophenyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 155792277) has the molecular formula C17H9FN4 and a molecular weight of 288.29 g/mol. Its IUPAC name is 11-(3-fluoro-4-isocyanophenyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-(3-fluoro-4-isocyanophenyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 155792277 |
| Molecular Formula | C17H9FN4 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 11-(3-fluoro-4-isocyanophenyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(n2)[nH]c2ccncc23)cc1F |
| InChI | InChI=1S/C17H9FN4/c1-19-16-4-2-10(8-13(16)18)14-5-3-11-12-9-20-7-6-15(12)22-17(11)21-14/h2-9H,(H,21,22) |
| InChIKey | OUJMBVBAYFEEMT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|