C9H18BNO4 — CID 155793084
(2S,3R,5R)-3-(3-boronopropyl)-5-methylpyrrolidine-2-carboxylic acid (PubChem CID 155793084) has the molecular formula C9H18BNO4 and a molecular weight of 215.06 g/mol. Its IUPAC name is (2S,3R,5R)-3-(3-boronopropyl)-5-methylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,5R)-3-(3-boronopropyl)-5-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155793084 |
| Molecular Formula | C9H18BNO4 |
| Molecular Weight | 215.06 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2S,3R,5R)-3-(3-boronopropyl)-5-methylpyrrolidine-2-carboxylic acid |
| SMILES | C[C@@H]1C[C@@H](CCCB(O)O)[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C9H18BNO4/c1-6-5-7(3-2-4-10(14)15)8(11-6)9(12)13/h6-8,11,14-15H,2-5H2,1H3,(H,12,13)/t6-,7-,8+/m1/s1 |
| InChIKey | QYJNNXKXXHBTON-PRJMDXOYSA-N |
| XLogP | -0.31 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.06 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|