C19H30BNO6 — CID 155793118
1-O-tert-butyl 2-O-methyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyrrole-1,2-dicarboxylate (PubChem CID 155793118) has the molecular formula C19H30BNO6 and a molecular weight of 379.26 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyrrole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793118 |
| Molecular Formula | C19H30BNO6 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyrrole-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(CCB2OC(C)(C)C(C)(C)O2)cn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30BNO6/c1-17(2,3)25-16(23)21-12-13(11-14(21)15(22)24-8)9-10-20-26-18(4,5)19(6,7)27-20/h11-12H,9-10H2,1-8H3 |
| InChIKey | RTRUUQVURPSBNT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|