C40H30N5OPtS-3 — CID 155794704
CID 155794704 (PubChem CID 155794704) has the molecular formula C40H30N5OPtS-3 and a molecular weight of 823.86 g/mol.
| Compound Name | CID 155794704 |
|---|---|
| PubChem CID | 155794704 |
| Molecular Formula | C40H30N5OPtS-3 |
| Molecular Weight | 823.86 g/mol |
| Exact Mass | 823.18 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)ccc2)c2c1ccc1sc3ncccc3c21.[Pt] |
| InChI | InChI=1S/C40H30N5OS.Pt/c1-40(2,3)25-18-20-41-36(21-25)45-32-13-6-5-11-29(32)30-15-14-28(23-34(30)45)46-27-10-7-9-26(22-27)44-24-43(4)33-16-17-35-37(38(33)44)31-12-8-19-42-39(31)47-35;/h5-21,24H,1-4H3;/q-3; |
| InChIKey | KFKUIPUVFHJDSA-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.86 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|