C13H16ClCsO2S — CID 155795513
cesium (4R)-2-[(3-chloro-2-methoxyphenyl)methylsulfanyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-ide (PubChem CID 155795513) has the molecular formula C13H16ClCsO2S and a molecular weight of 404.69 g/mol. Its IUPAC name is cesium (4R)-2-[(3-chloro-2-methoxyphenyl)methylsulfanyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-ide.
| Compound Name | cesium (4R)-2-[(3-chloro-2-methoxyphenyl)methylsulfanyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-ide |
|---|---|
| PubChem CID | 155795513 |
| Molecular Formula | C13H16ClCsO2S |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | cesium (4R)-2-[(3-chloro-2-methoxyphenyl)methylsulfanyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-ide |
| SMILES | COc1c(Cl)cccc1CSC1C[C@@H](C)[CH-]O1.[Cs+] |
| InChI | InChI=1S/C13H16ClO2S.Cs/c1-9-6-12(16-7-9)17-8-10-4-3-5-11(14)13(10)15-2;/h3-5,7,9,12H,6,8H2,1-2H3;/q-1;+1/t9-,12?;/m1./s1 |
| InChIKey | SYLZWTFYUFTAKF-SWHRJYHISA-N |
| XLogP | 1.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|