C36H33FN6O4 — CID 155796426
benzyl 4-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]piperazine-1-carboxylate (PubChem CID 155796426) has the molecular formula C36H33FN6O4 and a molecular weight of 632.70 g/mol. Its IUPAC name is benzyl 4-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155796426 |
| Molecular Formula | C36H33FN6O4 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | benzyl 4-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]piperazine-1-carboxylate |
| SMILES | COc1nc2ccccc2cc1-c1cnc(C2CN(C(=O)OCc3ccccc3)CCN2C(=O)Cc2c(C)[nH]c3ccc(F)cc23)[nH]1 |
| InChI | InChI=1S/C36H33FN6O4/c1-22-26(27-17-25(37)12-13-30(27)39-22)18-33(44)43-15-14-42(36(45)47-21-23-8-4-3-5-9-23)20-32(43)34-38-19-31(40-34)28-16-24-10-6-7-11-29(24)41-35(28)46-2/h3-13,16-17,19,32,39H,14-15,18,20-21H2,1-2H3,(H,38,40) |
| InChIKey | WKPSQZHVEXCMBS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|