About 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione
5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione (PubChem CID 155796522) has the molecular formula C5H2BrN3S2
and a molecular weight of 248.13 g/mol. Its IUPAC name is 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione.
Molecular Properties
| Compound Name | 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione |
| PubChem CID | 155796522 |
| Molecular Formula | C5H2BrN3S2 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 246.89 |
| IUPAC Name | 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione |
| SMILES | S=c1[nH]c2nc(Br)cnc2s1 |
| InChI | InChI=1S/C5H2BrN3S2/c6-2-1-7-4-3(8-2)9-5(10)11-4/h1H,(H,8,9,10) |
| InChIKey | CCDXZPCGNSVIRY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione?
The IUPAC name of 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione (CID 155796522) is 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione.
What is the SMILES notation for 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione?
The canonical SMILES for 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione is S=c1[nH]c2nc(Br)cnc2s1.
What is the InChIKey of 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione?
The InChIKey is CCDXZPCGNSVIRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BrN3S2/c6-2-1-7-4-3(8-2)9-5(10)11-4/h1H,(H,8,9,10).
What are the key properties of 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione?
5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione has a molecular weight of 248.13 g/mol, XLogP of 2.51, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione is sourced from PubChem (CID 155796522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).