About cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane
cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane (PubChem CID 155796726) has the molecular formula C22H22SSi
and a molecular weight of 346.57 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane |
| PubChem CID | 155796726 |
| Molecular Formula | C22H22SSi |
| Molecular Weight | 346.57 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane |
| SMILES | Cc1ccc(-c2ccccc3c([Si](C)(C)C4C=CC=C4)ccc2-3)s1 |
| InChI | InChI=1S/C22H22SSi/c1-16-12-14-21(23-16)19-10-6-7-11-20-18(19)13-15-22(20)24(2,3)17-8-4-5-9-17/h4-15,17H,1-3H3 |
| InChIKey | JYEPTUVPQDGQDL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane?
The IUPAC name of cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane (CID 155796726) is cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane.
What is the SMILES notation for cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane?
The canonical SMILES for cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane is Cc1ccc(-c2ccccc3c([Si](C)(C)C4C=CC=C4)ccc2-3)s1.
What is the InChIKey of cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane?
The InChIKey is JYEPTUVPQDGQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22SSi/c1-16-12-14-21(23-16)19-10-6-7-11-20-18(19)13-15-22(20)24(2,3)17-8-4-5-9-17/h4-15,17H,1-3H3.
What are the key properties of cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane?
cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane has a molecular weight of 346.57 g/mol, XLogP of 6.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-yl-dimethyl-[4-(5-methylthiophen-2-yl)azulen-1-yl]silane is sourced from PubChem (CID 155796726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).