C21H11F5O4S — CID 155796930
[3,4,5,7-tetrafluoro-6-(7-fluoronaphthalen-1-yl)-1-hydroxynaphthalen-2-yl] methanesulfonate (PubChem CID 155796930) has the molecular formula C21H11F5O4S and a molecular weight of 454.37 g/mol. Its IUPAC name is [3,4,5,7-tetrafluoro-6-(7-fluoronaphthalen-1-yl)-1-hydroxynaphthalen-2-yl] methanesulfonate.
| Compound Name | [3,4,5,7-tetrafluoro-6-(7-fluoronaphthalen-1-yl)-1-hydroxynaphthalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 155796930 |
| Molecular Formula | C21H11F5O4S |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | [3,4,5,7-tetrafluoro-6-(7-fluoronaphthalen-1-yl)-1-hydroxynaphthalen-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1c(F)c(F)c2c(F)c(-c3cccc4ccc(F)cc34)c(F)cc2c1O |
| InChI | InChI=1S/C21H11F5O4S/c1-31(28,29)30-21-19(26)18(25)16-13(20(21)27)8-14(23)15(17(16)24)11-4-2-3-9-5-6-10(22)7-12(9)11/h2-8,27H,1H3 |
| InChIKey | DTMNFUYMGWKPDI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|