About 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide
2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide (PubChem CID 15579705) has the molecular formula C22H20F3N2OP
and a molecular weight of 416.38 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide |
| PubChem CID | 15579705 |
| Molecular Formula | C22H20F3N2OP |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide |
| SMILES | O=C(NCCN=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H20F3N2OP/c23-22(24,25)21(28)26-16-17-27-29(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2,(H,26,28) |
| InChIKey | INQQVVXSLSLHEX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide?
The IUPAC name of 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide (CID 15579705) is 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide.
What is the SMILES notation for 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide?
The canonical SMILES for 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide is O=C(NCCN=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide?
The InChIKey is INQQVVXSLSLHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F3N2OP/c23-22(24,25)21(28)26-16-17-27-29(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2,(H,26,28).
What are the key properties of 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide?
2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide has a molecular weight of 416.38 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-[2-[(triphenyl-λ5-phosphanylidene)amino]ethyl]acetamide is sourced from PubChem (CID 15579705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).