C25H33N5O2 — CID 155797554
(E)-3-[4-[6-(9-azabicyclo[3.3.1]nonan-3-ylmethylamino)pyridazin-3-yl]-3-hydroxyphenyl]-N,N-dimethylbut-2-enamide (PubChem CID 155797554) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (E)-3-[4-[6-(9-azabicyclo[3.3.1]nonan-3-ylmethylamino)pyridazin-3-yl]-3-hydroxyphenyl]-N,N-dimethylbut-2-enamide.
| Compound Name | (E)-3-[4-[6-(9-azabicyclo[3.3.1]nonan-3-ylmethylamino)pyridazin-3-yl]-3-hydroxyphenyl]-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 155797554 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (E)-3-[4-[6-(9-azabicyclo[3.3.1]nonan-3-ylmethylamino)pyridazin-3-yl]-3-hydroxyphenyl]-N,N-dimethylbut-2-enamide |
| SMILES | C/C(=C\C(=O)N(C)C)c1ccc(-c2ccc(NCC3CC4CCCC(C3)N4)nn2)c(O)c1 |
| InChI | InChI=1S/C25H33N5O2/c1-16(11-25(32)30(2)3)18-7-8-21(23(31)14-18)22-9-10-24(29-28-22)26-15-17-12-19-5-4-6-20(13-17)27-19/h7-11,14,17,19-20,27,31H,4-6,12-13,15H2,1-3H3,(H,26,29)/b16-11+ |
| InChIKey | ICDBXCRJNFJXQG-LFIBNONCSA-N |
| XLogP | 3.67 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|