C9H3F8N — CID 15579768
5,5,6,6,7,7,8,8-octafluoroquinoline (PubChem CID 15579768) has the molecular formula C9H3F8N and a molecular weight of 277.11 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8-octafluoroquinoline.
| Compound Name | 5,5,6,6,7,7,8,8-octafluoroquinoline |
|---|---|
| PubChem CID | 15579768 |
| Molecular Formula | C9H3F8N |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 5,5,6,6,7,7,8,8-octafluoroquinoline |
| SMILES | FC1(F)c2cccnc2C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H3F8N/c10-6(11)4-2-1-3-18-5(4)7(12,13)9(16,17)8(6,14)15/h1-3H |
| InChIKey | NXZZUCICIBCAPN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|