C28H30F2N6O6S — CID 155797740
(2R,3R,4S,5R,6S)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(3R,4R,5S)-5-[4-(3-fluorophenyl)triazol-1-yl]-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxyoxan-3-ol (PubChem CID 155797740) has the molecular formula C28H30F2N6O6S and a molecular weight of 616.65 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(3R,4R,5S)-5-[4-(3-fluorophenyl)triazol-1-yl]-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(3R,4R,5S)-5-[4-(3-fluorophenyl)triazol-1-yl]-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 155797740 |
| Molecular Formula | C28H30F2N6O6S |
| Molecular Weight | 616.65 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | (2R,3R,4S,5R,6S)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(3R,4R,5S)-5-[4-(3-fluorophenyl)triazol-1-yl]-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cccc(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1S[C@@H]1COC[C@H](n2cc(-c3cccc(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C28H30F2N6O6S/c1-40-27-24(36-11-20(32-34-36)16-5-3-7-18(30)9-16)26(39)22(12-37)42-28(27)43-23-14-41-13-21(25(23)38)35-10-19(31-33-35)15-4-2-6-17(29)8-15/h2-11,21-28,37-39H,12-14H2,1H3/t21-,22+,23+,24-,25+,26-,27+,28-/m0/s1 |
| InChIKey | ZZPPNYSWCRTTQQ-YIQAVPGSSA-N |
| XLogP | 1.85 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.65 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |