C28H35F3N6O6S — CID 155797744
(2R,3R,4S,5R,6S)-6-[(3R,4R,5S)-5-(4-cyclohexyltriazol-1-yl)-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 155797744) has the molecular formula C28H35F3N6O6S and a molecular weight of 640.69 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-[(3R,4R,5S)-5-(4-cyclohexyltriazol-1-yl)-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-6-[(3R,4R,5S)-5-(4-cyclohexyltriazol-1-yl)-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 155797744 |
| Molecular Formula | C28H35F3N6O6S |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-[(3R,4R,5S)-5-(4-cyclohexyltriazol-1-yl)-4-hydroxyoxan-3-yl]sulfanyl-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1S[C@@H]1COC[C@H](n2cc(C3CCCCC3)nn2)[C@H]1O |
| InChI | InChI=1S/C28H35F3N6O6S/c1-41-27-24(37-10-19(33-35-37)15-7-16(29)23(31)17(30)8-15)26(40)21(11-38)43-28(27)44-22-13-42-12-20(25(22)39)36-9-18(32-34-36)14-5-3-2-4-6-14/h7-10,14,20-22,24-28,38-40H,2-6,11-13H2,1H3/t20-,21+,22+,24-,25+,26-,27+,28-/m0/s1 |
| InChIKey | KYUWWJKKGSQBSZ-XBSVYHDWSA-N |
| XLogP | 2.37 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|