C14H24CuIN4 — CID 155798209
2-[2-[(dimethylamino)methyl]phenyl]-1,1,3,3-tetramethylguanidine;iodocopper (PubChem CID 155798209) has the molecular formula C14H24CuIN4 and a molecular weight of 438.82 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]phenyl]-1,1,3,3-tetramethylguanidine;iodocopper.
| Compound Name | 2-[2-[(dimethylamino)methyl]phenyl]-1,1,3,3-tetramethylguanidine;iodocopper |
|---|---|
| PubChem CID | 155798209 |
| Molecular Formula | C14H24CuIN4 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]phenyl]-1,1,3,3-tetramethylguanidine;iodocopper |
| SMILES | CN(C)Cc1ccccc1N=C(N(C)C)N(C)C.[Cu]I |
| InChI | InChI=1S/C14H24N4.Cu.HI/c1-16(2)11-12-9-7-8-10-13(12)15-14(17(3)4)18(5)6;;/h7-10H,11H2,1-6H3;;1H/q;+1;/p-1 |
| InChIKey | DTVVDHUKUBSTJW-UHFFFAOYSA-M |
| XLogP | 2.74 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|