C18H25FN4O2 — CID 155798253
2-[5-(cyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-4-ethyl-5-fluoro-1H-pyrimidin-6-one (PubChem CID 155798253) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[5-(cyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-4-ethyl-5-fluoro-1H-pyrimidin-6-one.
| Compound Name | 2-[5-(cyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-4-ethyl-5-fluoro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155798253 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[5-(cyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-4-ethyl-5-fluoro-1H-pyrimidin-6-one |
| SMILES | CCc1nc(N2CC3CN(C(=O)C4CCCC4)CC3C2)[nH]c(=O)c1F |
| InChI | InChI=1S/C18H25FN4O2/c1-2-14-15(19)16(24)21-18(20-14)23-9-12-7-22(8-13(12)10-23)17(25)11-5-3-4-6-11/h11-13H,2-10H2,1H3,(H,20,21,24) |
| InChIKey | UAHJCHWAHRYWQF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |