C17H17N9 — CID 155798954
3-[5-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrazine-2-carbonitrile (PubChem CID 155798954) has the molecular formula C17H17N9 and a molecular weight of 347.39 g/mol. Its IUPAC name is 3-[5-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[5-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 155798954 |
| Molecular Formula | C17H17N9 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-[5-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrazine-2-carbonitrile |
| SMILES | Cn1cnc2c(N3CC4CN(c5nccnc5C#N)CC4C3)ncnc21 |
| InChI | InChI=1S/C17H17N9/c1-24-10-23-14-16(24)21-9-22-17(14)26-7-11-5-25(6-12(11)8-26)15-13(4-18)19-2-3-20-15/h2-3,9-12H,5-8H2,1H3 |
| InChIKey | KMLIYSCUVRTAGG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |