C20H25N7O2S — CID 155799377
(2,4-dimethyl-1,3-thiazol-5-yl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 155799377) has the molecular formula C20H25N7O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 155799377 |
| Molecular Formula | C20H25N7O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[2-[9-(2-methoxyethyl)purin-6-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | COCCn1cnc2c(N3CC4CN(C(=O)c5sc(C)nc5C)CC4C3)ncnc21 |
| InChI | InChI=1S/C20H25N7O2S/c1-12-17(30-13(2)24-12)20(28)27-8-14-6-26(7-15(14)9-27)19-16-18(21-10-22-19)25(11-23-16)4-5-29-3/h10-11,14-15H,4-9H2,1-3H3 |
| InChIKey | BIVHXKQVWNLLJS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |