C19H23N7O3S — CID 155799535
9-(2-methoxyethyl)-6-(5-pyridin-3-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)purine (PubChem CID 155799535) has the molecular formula C19H23N7O3S and a molecular weight of 429.51 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-6-(5-pyridin-3-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)purine.
| Compound Name | 9-(2-methoxyethyl)-6-(5-pyridin-3-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)purine |
|---|---|
| PubChem CID | 155799535 |
| Molecular Formula | C19H23N7O3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 9-(2-methoxyethyl)-6-(5-pyridin-3-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)purine |
| SMILES | COCCn1cnc2c(N3CC4CN(S(=O)(=O)c5cccnc5)CC4C3)ncnc21 |
| InChI | InChI=1S/C19H23N7O3S/c1-29-6-5-24-13-23-17-18(24)21-12-22-19(17)25-8-14-10-26(11-15(14)9-25)30(27,28)16-3-2-4-20-7-16/h2-4,7,12-15H,5-6,8-11H2,1H3 |
| InChIKey | FQTFSWDSWVICQU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 106.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |