About 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide
4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide (PubChem CID 155799896) has the molecular formula C15H19N5O2
and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide |
| PubChem CID | 155799896 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide |
| SMILES | Cc1nn(C)cc1CN1CC(Oc2ccnc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C15H19N5O2/c1-10-11(6-19(2)18-10)7-20-8-13(9-20)22-12-3-4-17-14(5-12)15(16)21/h3-6,13H,7-9H2,1-2H3,(H2,16,21) |
| InChIKey | RZAZGTKAQICCOP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide?
The IUPAC name of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide (CID 155799896) is 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide.
What is the SMILES notation for 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide?
The canonical SMILES for 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide is Cc1nn(C)cc1CN1CC(Oc2ccnc(C(N)=O)c2)C1.
What is the InChIKey of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide?
The InChIKey is RZAZGTKAQICCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O2/c1-10-11(6-19(2)18-10)7-20-8-13(9-20)22-12-3-4-17-14(5-12)15(16)21/h3-6,13H,7-9H2,1-2H3,(H2,16,21).
What are the key properties of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide?
4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide has a molecular weight of 301.35 g/mol, XLogP of 0.49, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]azetidin-3-yl]oxypyridine-2-carboxamide is sourced from PubChem (CID 155799896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).