About 2,4-D-isobutyl
2,4-D-isobutyl (PubChem CID 15580) has the molecular formula C12H14Cl2O3
and a molecular weight of 277.14 g/mol. Its IUPAC name is 2-methylpropyl 2-(2,4-dichlorophenoxy)acetate.
Molecular Properties
| Compound Name | 2,4-D-isobutyl |
| PubChem CID | 15580 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-methylpropyl 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CC(C)COC(=O)COC1=C(C=C(C=C1)Cl)Cl |
| InChI | InChI=1S/C12H14Cl2O3/c1-8(2)6-17-12(15)7-16-11-4-3-9(13)5-10(11)14/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | GPSGZZSRFJXXBA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 246 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-D-isobutyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-D-isobutyl?
The IUPAC name of 2,4-D-isobutyl (CID 15580) is 2-methylpropyl 2-(2,4-dichlorophenoxy)acetate.
What is the SMILES notation for 2,4-D-isobutyl?
The canonical SMILES for 2,4-D-isobutyl is CC(C)COC(=O)COC1=C(C=C(C=C1)Cl)Cl.
What is the InChIKey of 2,4-D-isobutyl?
The InChIKey is GPSGZZSRFJXXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2O3/c1-8(2)6-17-12(15)7-16-11-4-3-9(13)5-10(11)14/h3-5,8H,6-7H2,1-2H3.
What are the key properties of 2,4-D-isobutyl?
2,4-D-isobutyl has a molecular weight of 277.14 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-D-isobutyl is sourced from PubChem (CID 15580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).