C18H21F3N6O — CID 155800202
4-[2-[4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]morpholine (PubChem CID 155800202) has the molecular formula C18H21F3N6O and a molecular weight of 394.40 g/mol. Its IUPAC name is 4-[2-[4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-[4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 155800202 |
| Molecular Formula | C18H21F3N6O |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[2-[4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]morpholine |
| SMILES | FC(F)(F)c1cc(N2CCN(c3nccc(N4CCOCC4)n3)CC2)ccn1 |
| InChI | InChI=1S/C18H21F3N6O/c19-18(20,21)15-13-14(1-3-22-15)25-5-7-27(8-6-25)17-23-4-2-16(24-17)26-9-11-28-12-10-26/h1-4,13H,5-12H2 |
| InChIKey | AJEWRFANFCXDOY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |