About N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate
N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate (PubChem CID 15580043) has the molecular formula C25H23BF4N2
and a molecular weight of 438.28 g/mol. Its IUPAC name is N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate.
Molecular Properties
| Compound Name | N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate |
| PubChem CID | 15580043 |
| Molecular Formula | C25H23BF4N2 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate |
| SMILES | CCN[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C25H23N2.BF4/c1-2-26-27-24(21-14-8-4-9-15-21)18-23(20-12-6-3-7-13-20)19-25(27)22-16-10-5-11-17-22;2-1(3,4)5/h3-19,26H,2H2,1H3;/q+1;-1 |
| InChIKey | GFMNTFJEEGYAFQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate?
The IUPAC name of N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate (CID 15580043) is N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate.
What is the SMILES notation for N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate?
The canonical SMILES for N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate is CCN[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate?
The InChIKey is GFMNTFJEEGYAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N2.BF4/c1-2-26-27-24(21-14-8-4-9-15-21)18-23(20-12-6-3-7-13-20)19-25(27)22-16-10-5-11-17-22;2-1(3,4)5/h3-19,26H,2H2,1H3;/q+1;-1.
What are the key properties of N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate?
N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate has a molecular weight of 438.28 g/mol, XLogP of 6.84, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,4,6-triphenylpyridin-1-ium-1-amine tetrafluoroborate is sourced from PubChem (CID 15580043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).