C21H41O8P — CID 155801611
[(2S)-2-nonanoyloxy-3-phosphonooxypropyl] nonanoate (PubChem CID 155801611) has the molecular formula C21H41O8P and a molecular weight of 452.53 g/mol. Its IUPAC name is [(2S)-2-nonanoyloxy-3-phosphonooxypropyl] nonanoate.
| Compound Name | [(2S)-2-nonanoyloxy-3-phosphonooxypropyl] nonanoate |
|---|---|
| PubChem CID | 155801611 |
| Molecular Formula | C21H41O8P |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | [(2S)-2-nonanoyloxy-3-phosphonooxypropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC[C@@H](COP(=O)(O)O)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C21H41O8P/c1-3-5-7-9-11-13-15-20(22)27-17-19(18-28-30(24,25)26)29-21(23)16-14-12-10-8-6-4-2/h19H,3-18H2,1-2H3,(H2,24,25,26)/t19-/m0/s1 |
| InChIKey | AZNRRUXZATUWCK-IBGZPJMESA-N |
| XLogP | 5.05 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|