About (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide
(Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide (PubChem CID 155801721) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide.
Molecular Properties
| Compound Name | (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide |
| PubChem CID | 155801721 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide |
| SMILES | CN(C)C(=O)/C=C\Cc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H13N3O2/c1-13(2)10(15)5-3-4-8-6-7-9(14)12-11-8/h3,5-7H,4H2,1-2H3,(H,12,14)/b5-3- |
| InChIKey | YLSQBVUTJNHWMA-HYXAFXHYSA-N |
| XLogP | -0.04 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide?
The IUPAC name of (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide (CID 155801721) is (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide.
What is the SMILES notation for (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide?
The canonical SMILES for (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide is CN(C)C(=O)/C=C\Cc1ccc(=O)[nH]n1.
What is the InChIKey of (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide?
The InChIKey is YLSQBVUTJNHWMA-HYXAFXHYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-13(2)10(15)5-3-4-8-6-7-9(14)12-11-8/h3,5-7H,4H2,1-2H3,(H,12,14)/b5-3-.
What are the key properties of (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide?
(Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide has a molecular weight of 207.23 g/mol, XLogP of -0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethyl-4-(6-oxo-1H-pyridazin-3-yl)but-2-enamide is sourced from PubChem (CID 155801721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).