C40H30N4O16-8 — CID 155802556
3-[7,12,17-tris(2-carboxylatoethyl)-3,8,13,18-tetrakis(carboxylatomethyl)-21,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 155802556) has the molecular formula C40H30N4O16-8 and a molecular weight of 822.69 g/mol. Its IUPAC name is 3-[7,12,17-tris(2-carboxylatoethyl)-3,8,13,18-tetrakis(carboxylatomethyl)-21,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | 3-[7,12,17-tris(2-carboxylatoethyl)-3,8,13,18-tetrakis(carboxylatomethyl)-21,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 155802556 |
| Molecular Formula | C40H30N4O16-8 |
| Molecular Weight | 822.69 g/mol |
| Exact Mass | 822.17 |
| IUPAC Name | 3-[7,12,17-tris(2-carboxylatoethyl)-3,8,13,18-tetrakis(carboxylatomethyl)-21,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | O=C([O-])CCC1=C(CC(=O)[O-])c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CC(=O)[O-])c5CCC(=O)[O-])c(CC(=O)[O-])c4CCC(=O)[O-])C(CC(=O)[O-])=C3CCC(=O)[O-] |
| InChI | InChI=1S/C40H38N4O16/c45-33(46)5-1-17-21(9-37(53)54)29-14-26-19(3-7-35(49)50)23(11-39(57)58)31(43-26)16-28-20(4-8-36(51)52)24(12-40(59)60)32(44-28)15-27-18(2-6-34(47)48)22(10-38(55)56)30(42-27)13-25(17)41-29/h13-16,41-42H,1-12H2,(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)/p-8/b25-13-,26-14-,27-15-,28-16-,29-14-,30-13-,31-16-,32-15- |
| InChIKey | MOTVYDVWODTRDF-JRHDEHKPSA-F |
| XLogP | -6.57 |
| TPSA | 378.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.69 |
| LogP ≤ 5 | -6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |