C25H24N8O3 — CID 155802757
3-ethyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)-7-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]-4,5-dihydropurine-2,6-dione (PubChem CID 155802757) has the molecular formula C25H24N8O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is 3-ethyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)-7-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-ethyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)-7-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 155802757 |
| Molecular Formula | C25H24N8O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 3-ethyl-8-(imidazo[1,2-a]pyridin-2-ylmethyl)-7-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]-4,5-dihydropurine-2,6-dione |
| SMILES | CCN1C(=O)NC(=O)C2C1N=C(Cc1cn3ccccc3n1)N2Cc1ccc(-c2nc(C)no2)cc1 |
| InChI | InChI=1S/C25H24N8O3/c1-3-32-22-21(23(34)29-25(32)35)33(13-16-7-9-17(10-8-16)24-26-15(2)30-36-24)20(28-22)12-18-14-31-11-5-4-6-19(31)27-18/h4-11,14,21-22H,3,12-13H2,1-2H3,(H,29,34,35) |
| InChIKey | JDLZKMUWAQLBIX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |