C27H35FN4O — CID 155802792
N-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 155802792) has the molecular formula C27H35FN4O and a molecular weight of 450.60 g/mol. Its IUPAC name is N-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 155802792 |
| Molecular Formula | C27H35FN4O |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | N-benzyl-5-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1NNC2CCC(c3cc(F)cc(CN4CCCCC4)c3)CC21 |
| InChI | InChI=1S/C27H35FN4O/c28-23-14-20(18-32-11-5-2-6-12-32)13-22(15-23)21-9-10-25-24(16-21)26(31-30-25)27(33)29-17-19-7-3-1-4-8-19/h1,3-4,7-8,13-15,21,24-26,30-31H,2,5-6,9-12,16-18H2,(H,29,33) |
| InChIKey | FYQJTSBNJUEGDX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |