C22H16ClF2N5O — CID 155803044
5-[3-chloro-5-(4-fluorophenyl)-2-pyridinyl]-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-fluoropyridine-2-carboxamide (PubChem CID 155803044) has the molecular formula C22H16ClF2N5O and a molecular weight of 439.85 g/mol. Its IUPAC name is 5-[3-chloro-5-(4-fluorophenyl)-2-pyridinyl]-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-fluoropyridine-2-carboxamide.
| Compound Name | 5-[3-chloro-5-(4-fluorophenyl)-2-pyridinyl]-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 155803044 |
| Molecular Formula | C22H16ClF2N5O |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 5-[3-chloro-5-(4-fluorophenyl)-2-pyridinyl]-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-fluoropyridine-2-carboxamide |
| SMILES | N#CN1CC[C@@H](NC(=O)c2ncc(-c3ncc(-c4ccc(F)cc4)cc3Cl)cc2F)C1 |
| InChI | InChI=1S/C22H16ClF2N5O/c23-18-7-14(13-1-3-16(24)4-2-13)9-27-20(18)15-8-19(25)21(28-10-15)22(31)29-17-5-6-30(11-17)12-26/h1-4,7-10,17H,5-6,11H2,(H,29,31)/t17-/m1/s1 |
| InChIKey | MQSLLZSRNBUQNP-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|