C26H28N3O2S+ — CID 155803096
1-[6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]quinolin-1-ium-1-yl]ethanone (PubChem CID 155803096) has the molecular formula C26H28N3O2S+ and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-[6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]quinolin-1-ium-1-yl]ethanone.
| Compound Name | 1-[6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]quinolin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 155803096 |
| Molecular Formula | C26H28N3O2S+ |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[6-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propoxy]quinolin-1-ium-1-yl]ethanone |
| SMILES | CC(=O)[n+]1cccc2cc(OCCCN3CCN(c4cccc5sccc45)CC3)ccc21 |
| InChI | InChI=1S/C26H28N3O2S/c1-20(30)29-12-3-5-21-19-22(8-9-24(21)29)31-17-4-11-27-13-15-28(16-14-27)25-6-2-7-26-23(25)10-18-32-26/h2-3,5-10,12,18-19H,4,11,13-17H2,1H3/q+1 |
| InChIKey | GZMZQSGPGCPDAV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|