C31H22ClN3O3 — CID 155803121
2-[3-[3-chloro-5-(2-phenylethoxy)phenyl]-2,6-dioxo-1-pyridin-3-yl-3H-pyridin-5-yl]benzonitrile (PubChem CID 155803121) has the molecular formula C31H22ClN3O3 and a molecular weight of 519.99 g/mol. Its IUPAC name is 2-[3-[3-chloro-5-(2-phenylethoxy)phenyl]-2,6-dioxo-1-pyridin-3-yl-3H-pyridin-5-yl]benzonitrile.
| Compound Name | 2-[3-[3-chloro-5-(2-phenylethoxy)phenyl]-2,6-dioxo-1-pyridin-3-yl-3H-pyridin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 155803121 |
| Molecular Formula | C31H22ClN3O3 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 2-[3-[3-chloro-5-(2-phenylethoxy)phenyl]-2,6-dioxo-1-pyridin-3-yl-3H-pyridin-5-yl]benzonitrile |
| SMILES | N#Cc1ccccc1C1=CC(c2cc(Cl)cc(OCCc3ccccc3)c2)C(=O)N(c2cccnc2)C1=O |
| InChI | InChI=1S/C31H22ClN3O3/c32-24-15-23(16-26(17-24)38-14-12-21-7-2-1-3-8-21)28-18-29(27-11-5-4-9-22(27)19-33)31(37)35(30(28)36)25-10-6-13-34-20-25/h1-11,13,15-18,20,28H,12,14H2 |
| InChIKey | WKEFESVPTGIIBU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|