C21H13FO6 — CID 155803499
3-[(4-fluorophenyl)-(3-hydroxy-5-oxo-2H-furan-4-yl)methyl]-4-hydroxynaphthalene-1,2-dione (PubChem CID 155803499) has the molecular formula C21H13FO6 and a molecular weight of 380.33 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)-(3-hydroxy-5-oxo-2H-furan-4-yl)methyl]-4-hydroxynaphthalene-1,2-dione.
| Compound Name | 3-[(4-fluorophenyl)-(3-hydroxy-5-oxo-2H-furan-4-yl)methyl]-4-hydroxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 155803499 |
| Molecular Formula | C21H13FO6 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 3-[(4-fluorophenyl)-(3-hydroxy-5-oxo-2H-furan-4-yl)methyl]-4-hydroxynaphthalene-1,2-dione |
| SMILES | O=C1OCC(O)=C1C(C1=C(O)c2ccccc2C(=O)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H13FO6/c22-11-7-5-10(6-8-11)15(16-14(23)9-28-21(16)27)17-18(24)12-3-1-2-4-13(12)19(25)20(17)26/h1-8,15,23-24H,9H2 |
| InChIKey | SFTBZJVBCAKRRT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|