C25H34ClNO10 — CID 155803592
1-ethyl-4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-trien-3-yl)ethenyl]pyridin-1-ium perchlorate (PubChem CID 155803592) has the molecular formula C25H34ClNO10 and a molecular weight of 544.00 g/mol. Its IUPAC name is 1-ethyl-4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-trien-3-yl)ethenyl]pyridin-1-ium perchlorate.
| Compound Name | 1-ethyl-4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-trien-3-yl)ethenyl]pyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 155803592 |
| Molecular Formula | C25H34ClNO10 |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 1-ethyl-4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-trien-3-yl)ethenyl]pyridin-1-ium perchlorate |
| SMILES | CC[n+]1ccc(/C=C/C2COCCOCCOCCOCCOc3ccccc3O2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H34NO6.ClHO4/c1-2-26-11-9-22(10-12-26)7-8-23-21-30-18-17-28-14-13-27-15-16-29-19-20-31-24-5-3-4-6-25(24)32-23;2-1(3,4)5/h3-12,23H,2,13-21H2,1H3;(H,2,3,4,5)/q+1;/p-1/b8-7+; |
| InChIKey | BRWDJGHOTWPWAO-USRGLUTNSA-M |
| XLogP | -1.84 |
| TPSA | 151.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|