About (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol
(2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol (PubChem CID 155803740) has the molecular formula C3H4N2O2S2
and a molecular weight of 164.21 g/mol. Its IUPAC name is (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol.
Molecular Properties
| Compound Name | (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol |
| PubChem CID | 155803740 |
| Molecular Formula | C3H4N2O2S2 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 163.97 |
| IUPAC Name | (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol |
| SMILES | O=[N+]([O-])C1=CN[C@H](S)S1 |
| InChI | InChI=1S/C3H4N2O2S2/c6-5(7)2-1-4-3(8)9-2/h1,3-4,8H/t3-/m1/s1 |
| InChIKey | GXYJYVXPTXFTHE-GSVOUGTGSA-N |
| XLogP | 0.61 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol?
The IUPAC name of (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol (CID 155803740) is (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol.
What is the SMILES notation for (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol?
The canonical SMILES for (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol is O=[N+]([O-])C1=CN[C@H](S)S1.
What is the InChIKey of (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol?
The InChIKey is GXYJYVXPTXFTHE-GSVOUGTGSA-N. The full InChI is InChI=1S/C3H4N2O2S2/c6-5(7)2-1-4-3(8)9-2/h1,3-4,8H/t3-/m1/s1.
What are the key properties of (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol?
(2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol has a molecular weight of 164.21 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-nitro-2,3-dihydro-1,3-thiazole-2-thiol is sourced from PubChem (CID 155803740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).