C9H14Cl5OP — CID 15580389
(E)-1,2,3-trichloro-4-dichlorophosphoryl-2,5,5-trimethylhex-3-ene (PubChem CID 15580389) has the molecular formula C9H14Cl5OP and a molecular weight of 346.45 g/mol. Its IUPAC name is (E)-1,2,3-trichloro-4-dichlorophosphoryl-2,5,5-trimethylhex-3-ene.
| Compound Name | (E)-1,2,3-trichloro-4-dichlorophosphoryl-2,5,5-trimethylhex-3-ene |
|---|---|
| PubChem CID | 15580389 |
| Molecular Formula | C9H14Cl5OP |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 343.92 |
| IUPAC Name | (E)-1,2,3-trichloro-4-dichlorophosphoryl-2,5,5-trimethylhex-3-ene |
| SMILES | CC(C)(C)/C(=C(\Cl)C(C)(Cl)CCl)P(=O)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl5OP/c1-8(2,3)7(16(13,14)15)6(11)9(4,12)5-10/h5H2,1-4H3/b7-6+ |
| InChIKey | IDVRFJIQLYTJEZ-VOTSOKGWSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|